About 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene
2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene (PubChem CID 58516556) has the molecular formula C15H10F4I2O2
and a molecular weight of 552.04 g/mol. Its IUPAC name is 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene.
Molecular Properties
| Compound Name | 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene |
| PubChem CID | 58516556 |
| Molecular Formula | C15H10F4I2O2 |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.87 |
| IUPAC Name | 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene |
| SMILES | Fc1cc(F)c(OCCCOc2c(F)cc(F)cc2I)c(I)c1 |
| InChI | InChI=1S/C15H10F4I2O2/c16-8-4-10(18)14(12(20)6-8)22-2-1-3-23-15-11(19)5-9(17)7-13(15)21/h4-7H,1-3H2 |
| InChIKey | AVACKPMKMKQZIL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene?
The IUPAC name of 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene (CID 58516556) is 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene.
What is the SMILES notation for 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene?
The canonical SMILES for 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene is Fc1cc(F)c(OCCCOc2c(F)cc(F)cc2I)c(I)c1.
What is the InChIKey of 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene?
The InChIKey is AVACKPMKMKQZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F4I2O2/c16-8-4-10(18)14(12(20)6-8)22-2-1-3-23-15-11(19)5-9(17)7-13(15)21/h4-7H,1-3H2.
What are the key properties of 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene?
2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene has a molecular weight of 552.04 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4-difluoro-6-iodophenoxy)propoxy]-1,5-difluoro-3-iodobenzene is sourced from PubChem (CID 58516556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).