C15H14Br2N2 — CID 58516893
4,12-dibromo-8-butyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 58516893) has the molecular formula C15H14Br2N2 and a molecular weight of 382.10 g/mol. Its IUPAC name is 4,12-dibromo-8-butyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,12-dibromo-8-butyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 58516893 |
| Molecular Formula | C15H14Br2N2 |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 4,12-dibromo-8-butyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCCCC1c2ccc(Br)nc2-c2nc(Br)ccc21 |
| InChI | InChI=1S/C15H14Br2N2/c1-2-3-4-9-10-5-7-12(16)18-14(10)15-11(9)6-8-13(17)19-15/h5-9H,2-4H2,1H3 |
| InChIKey | KAOVLEIPKJJJQB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|