C23H12F2I2N2 — CID 58516933
8,8-bis(4-fluorophenyl)-4,12-diiodo-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 58516933) has the molecular formula C23H12F2I2N2 and a molecular weight of 608.17 g/mol. Its IUPAC name is 8,8-bis(4-fluorophenyl)-4,12-diiodo-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8,8-bis(4-fluorophenyl)-4,12-diiodo-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 58516933 |
| Molecular Formula | C23H12F2I2N2 |
| Molecular Weight | 608.17 g/mol |
| Exact Mass | 607.91 |
| IUPAC Name | 8,8-bis(4-fluorophenyl)-4,12-diiodo-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Fc1ccc(C2(c3ccc(F)cc3)c3ccc(I)nc3-c3nc(I)ccc32)cc1 |
| InChI | InChI=1S/C23H12F2I2N2/c24-15-5-1-13(2-6-15)23(14-3-7-16(25)8-4-14)17-9-11-19(26)28-21(17)22-18(23)10-12-20(27)29-22/h1-12H |
| InChIKey | LNLSIFOPMCUCDX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.17 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|