C16H34O2 — CID 58517080
(2R,3S,4R,6R,8R)-2,4,6,8,10-pentamethylundecane-1,3-diol (PubChem CID 58517080) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (2R,3S,4R,6R,8R)-2,4,6,8,10-pentamethylundecane-1,3-diol.
| Compound Name | (2R,3S,4R,6R,8R)-2,4,6,8,10-pentamethylundecane-1,3-diol |
|---|---|
| PubChem CID | 58517080 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | (2R,3S,4R,6R,8R)-2,4,6,8,10-pentamethylundecane-1,3-diol |
| SMILES | CC(C)C[C@@H](C)C[C@@H](C)C[C@@H](C)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C16H34O2/c1-11(2)7-12(3)8-13(4)9-14(5)16(18)15(6)10-17/h11-18H,7-10H2,1-6H3/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | XQXBGFDDYQTJQR-QCODTGAPSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |