C16H10N4S2 — CID 58517352
2,8-di(cyclopenta-1,3-dien-1-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 58517352) has the molecular formula C16H10N4S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2,8-di(cyclopenta-1,3-dien-1-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-di(cyclopenta-1,3-dien-1-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 58517352 |
| Molecular Formula | C16H10N4S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2,8-di(cyclopenta-1,3-dien-1-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | C1=CCC(c2c3c(c(C4=CC=CC4)c4nsnc24)N=S=N3)=C1 |
| InChI | InChI=1S/C16H10N4S2/c1-2-6-9(5-1)11-13-15(19-21-17-13)12(10-7-3-4-8-10)16-14(11)18-22-20-16/h1-5,7H,6,8H2 |
| InChIKey | FVXOMENLVHAMKG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |