About iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide
iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide (PubChem CID 58517440) has the molecular formula C10H7IrN4-
and a molecular weight of 375.41 g/mol. Its IUPAC name is iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide.
Molecular Properties
| Compound Name | iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide |
| PubChem CID | 58517440 |
| Molecular Formula | C10H7IrN4- |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide |
| SMILES | Cc1c[c-]c2c(ccn3nnnc23)c1.[Ir] |
| InChI | InChI=1S/C10H7N4.Ir/c1-7-2-3-9-8(6-7)4-5-14-10(9)11-12-13-14;/h2,4-6H,1H3;/q-1; |
| InChIKey | WJFBCZQEHSEFDJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The IUPAC name of iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide (CID 58517440) is iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide.
What is the SMILES notation for iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The canonical SMILES for iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide is Cc1c[c-]c2c(ccn3nnnc23)c1.[Ir].
What is the InChIKey of iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The InChIKey is WJFBCZQEHSEFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N4.Ir/c1-7-2-3-9-8(6-7)4-5-14-10(9)11-12-13-14;/h2,4-6H,1H3;/q-1;.
What are the key properties of iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide?
iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide has a molecular weight of 375.41 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;8-methyl-10H-tetrazolo[5,1-a]isoquinolin-10-ide is sourced from PubChem (CID 58517440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).