About 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine
10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine (PubChem CID 58517476) has the molecular formula C22H15IrN3-2
and a molecular weight of 513.60 g/mol. Its IUPAC name is 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine.
Molecular Properties
| Compound Name | 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine |
| PubChem CID | 58517476 |
| Molecular Formula | C22H15IrN3-2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1cccc2ccn3ccnc3c12.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H7N2.C11H8N.Ir/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-3,5-8H;1-6,8-9H;/q2*-1; |
| InChIKey | AFQAGFGKYDIJGZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine?
The IUPAC name of 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine (CID 58517476) is 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine.
What is the SMILES notation for 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine?
The canonical SMILES for 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine is [Ir].[c-]1cccc2ccn3ccnc3c12.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine?
The InChIKey is AFQAGFGKYDIJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N2.C11H8N.Ir/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-3,5-8H;1-6,8-9H;/q2*-1;.
What are the key properties of 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine?
10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine has a molecular weight of 513.60 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-imidazo[2,1-a]isoquinolin-10-ide;iridium;2-phenylpyridine is sourced from PubChem (CID 58517476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).