About 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium
3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium (PubChem CID 58517570) has the molecular formula C15H16IrN3-
and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium |
| PubChem CID | 58517570 |
| Molecular Formula | C15H16IrN3- |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium |
| SMILES | CC(C)(C)Cc1cnc2c3[c-]cccc3ncn12.[Ir] |
| InChI | InChI=1S/C15H16N3.Ir/c1-15(2,3)8-11-9-16-14-12-6-4-5-7-13(12)17-10-18(11)14;/h4-5,7,9-10H,8H2,1-3H3;/q-1; |
| InChIKey | WNESXNWABFLXRA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium?
The IUPAC name of 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium (CID 58517570) is 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium.
What is the SMILES notation for 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium?
The canonical SMILES for 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium is CC(C)(C)Cc1cnc2c3[c-]cccc3ncn12.[Ir].
What is the InChIKey of 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium?
The InChIKey is WNESXNWABFLXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N3.Ir/c1-15(2,3)8-11-9-16-14-12-6-4-5-7-13(12)17-10-18(11)14;/h4-5,7,9-10H,8H2,1-3H3;/q-1;.
What are the key properties of 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium?
3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium has a molecular weight of 430.53 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropyl)-10H-imidazo[1,2-c]quinazolin-10-ide;iridium is sourced from PubChem (CID 58517570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).