C17H12N2 — CID 58517625
6-phenylimidazo[2,1-a]isoquinoline (PubChem CID 58517625) has the molecular formula C17H12N2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 6-phenylimidazo[2,1-a]isoquinoline.
| Compound Name | 6-phenylimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 58517625 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 6-phenylimidazo[2,1-a]isoquinoline |
| SMILES | c1ccc(-c2cn3ccnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C17H12N2/c1-2-6-13(7-3-1)16-12-19-11-10-18-17(19)15-9-5-4-8-14(15)16/h1-12H |
| InChIKey | JDGIOQWHZUHGKR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |