About 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline
3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline (PubChem CID 58517636) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline |
| PubChem CID | 58517636 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline |
| SMILES | Cc1c(C)n2c(C(C)(C)C)cnc2c2ccccc12 |
| InChI | InChI=1S/C17H20N2/c1-11-12(2)19-15(17(3,4)5)10-18-16(19)14-9-7-6-8-13(11)14/h6-10H,1-5H3 |
| InChIKey | SANPFHMSANHALC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline?
The IUPAC name of 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline (CID 58517636) is 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline.
What is the SMILES notation for 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline?
The canonical SMILES for 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline is Cc1c(C)n2c(C(C)(C)C)cnc2c2ccccc12.
What is the InChIKey of 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline?
The InChIKey is SANPFHMSANHALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-11-12(2)19-15(17(3,4)5)10-18-16(19)14-9-7-6-8-13(11)14/h6-10H,1-5H3.
What are the key properties of 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline?
3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline has a molecular weight of 252.36 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5,6-dimethylimidazo[2,1-a]isoquinoline is sourced from PubChem (CID 58517636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).