About iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide
iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide (PubChem CID 58517677) has the molecular formula C9H5IrN4-
and a molecular weight of 361.38 g/mol. Its IUPAC name is iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide.
Molecular Properties
| Compound Name | iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide |
| PubChem CID | 58517677 |
| Molecular Formula | C9H5IrN4- |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide |
| SMILES | [Ir].[c-]1cccc2ccn3nnnc3c12 |
| InChI | InChI=1S/C9H5N4.Ir/c1-2-4-8-7(3-1)5-6-13-9(8)10-11-12-13;/h1-3,5-6H;/q-1; |
| InChIKey | CCPHXWCJIOTIDS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The IUPAC name of iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide (CID 58517677) is iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide.
What is the SMILES notation for iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The canonical SMILES for iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide is [Ir].[c-]1cccc2ccn3nnnc3c12.
What is the InChIKey of iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide?
The InChIKey is CCPHXWCJIOTIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N4.Ir/c1-2-4-8-7(3-1)5-6-13-9(8)10-11-12-13;/h1-3,5-6H;/q-1;.
What are the key properties of iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide?
iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide has a molecular weight of 361.38 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;10H-tetrazolo[5,1-a]isoquinolin-10-ide is sourced from PubChem (CID 58517677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).