About 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline
9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline (PubChem CID 58517708) has the molecular formula C16H8FN3
and a molecular weight of 261.26 g/mol. Its IUPAC name is 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline |
| PubChem CID | 58517708 |
| Molecular Formula | C16H8FN3 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline |
| SMILES | [C-]#[N+]c1cn2c3cc(F)ccc3nc2c2ccccc12 |
| InChI | InChI=1S/C16H8FN3/c1-18-14-9-20-15-8-10(17)6-7-13(15)19-16(20)12-5-3-2-4-11(12)14/h2-9H |
| InChIKey | KIZAFPCBPAOGTK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline?
The IUPAC name of 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline (CID 58517708) is 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline.
What is the SMILES notation for 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline?
The canonical SMILES for 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline is [C-]#[N+]c1cn2c3cc(F)ccc3nc2c2ccccc12.
What is the InChIKey of 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline?
The InChIKey is KIZAFPCBPAOGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8FN3/c1-18-14-9-20-15-8-10(17)6-7-13(15)19-16(20)12-5-3-2-4-11(12)14/h2-9H.
What are the key properties of 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline?
9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline has a molecular weight of 261.26 g/mol, XLogP of 4.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-5-isocyanobenzimidazolo[2,1-a]isoquinoline is sourced from PubChem (CID 58517708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).