C22H27N2O2Pt- — CID 58517971
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum (PubChem CID 58517971) has the molecular formula C22H27N2O2Pt- and a molecular weight of 546.55 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
|---|---|
| PubChem CID | 58517971 |
| Molecular Formula | C22H27N2O2Pt- |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Pt].[c-]1cccc2ccn3ccnc3c12 |
| InChI | InChI=1S/C11H7N2.C11H20O2.Pt/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-3,5-8H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | IZTFTNSMSBLCBN-HXIBTQJOSA-N |
| XLogP | 5.37 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|