C34H12F6N4 — CID 58518254
10-N,12-N-diisocyano-2,8-bis(3,4,5-trifluorophenyl)indeno[2,1-b]fluorene-10,12-diimine (PubChem CID 58518254) has the molecular formula C34H12F6N4 and a molecular weight of 590.49 g/mol. Its IUPAC name is 10-N,12-N-diisocyano-2,8-bis(3,4,5-trifluorophenyl)indeno[2,1-b]fluorene-10,12-diimine.
| Compound Name | 10-N,12-N-diisocyano-2,8-bis(3,4,5-trifluorophenyl)indeno[2,1-b]fluorene-10,12-diimine |
|---|---|
| PubChem CID | 58518254 |
| Molecular Formula | C34H12F6N4 |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 10-N,12-N-diisocyano-2,8-bis(3,4,5-trifluorophenyl)indeno[2,1-b]fluorene-10,12-diimine |
| SMILES | [C-]#[N+]/N=c1/c2cc(-c3cc(F)c(F)c(F)c3)ccc2c2cc3c(cc12)/c(=N/[N+]#[C-])c1cc(-c2cc(F)c(F)c(F)c2)ccc13 |
| InChI | InChI=1S/C34H12F6N4/c1-41-43-33-23-7-15(17-9-27(35)31(39)28(36)10-17)3-5-19(23)21-13-22-20-6-4-16(18-11-29(37)32(40)30(38)12-18)8-24(20)34(44-42-2)26(22)14-25(21)33/h3-14H/b43-33-,44-34+ |
| InChIKey | LFFNIVIOYBMVBA-ARMJZBMLSA-N |
| XLogP | 8.81 |
| TPSA | 33.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|