C56H38N7OP — CID 58518389
N-[bis[6-(6-carbazol-9-yl-2-pyridinyl)-2-pyridinyl]phosphoryl]-N-phenylaniline (PubChem CID 58518389) has the molecular formula C56H38N7OP and a molecular weight of 855.94 g/mol. Its IUPAC name is N-[bis[6-(6-carbazol-9-yl-2-pyridinyl)-2-pyridinyl]phosphoryl]-N-phenylaniline.
| Compound Name | N-[bis[6-(6-carbazol-9-yl-2-pyridinyl)-2-pyridinyl]phosphoryl]-N-phenylaniline |
|---|---|
| PubChem CID | 58518389 |
| Molecular Formula | C56H38N7OP |
| Molecular Weight | 855.94 g/mol |
| Exact Mass | 855.29 |
| IUPAC Name | N-[bis[6-(6-carbazol-9-yl-2-pyridinyl)-2-pyridinyl]phosphoryl]-N-phenylaniline |
| SMILES | O=P(c1cccc(-c2cccc(-n3c4ccccc4c4ccccc43)n2)n1)(c1cccc(-c2cccc(-n3c4ccccc4c4ccccc43)n2)n1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C56H38N7OP/c64-65(63(39-19-3-1-4-20-39)40-21-5-2-6-22-40,55-37-17-29-47(59-55)45-27-15-35-53(57-45)61-49-31-11-7-23-41(49)42-24-8-12-32-50(42)61)56-38-18-30-48(60-56)46-28-16-36-54(58-46)62-51-33-13-9-25-43(51)44-26-10-14-34-52(44)62/h1-38H |
| InChIKey | JLTPCNYCSWIPTM-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.94 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|