C47H56B2N4O4 — CID 58518455
9-[4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]-3,6-ditert-butylcarbazole (PubChem CID 58518455) has the molecular formula C47H56B2N4O4 and a molecular weight of 762.61 g/mol. Its IUPAC name is 9-[4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 58518455 |
| Molecular Formula | C47H56B2N4O4 |
| Molecular Weight | 762.61 g/mol |
| Exact Mass | 762.45 |
| IUPAC Name | 9-[4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1nc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)nc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)n1 |
| InChI | InChI=1S/C47H56B2N4O4/c1-42(2,3)31-19-25-37-35(27-31)36-28-32(43(4,5)6)20-26-38(36)53(37)41-51-39(29-15-21-33(22-16-29)48-54-44(7,8)45(9,10)55-48)50-40(52-41)30-17-23-34(24-18-30)49-56-46(11,12)47(13,14)57-49/h15-28H,1-14H3 |
| InChIKey | XBQBJBWZYYNLBU-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.61 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|