C38H33N3O — CID 58518724
3,4-diphenyl-5-[4-(2,6,8-triethyldibenzofuran-4-yl)phenyl]-1,2,4-triazole (PubChem CID 58518724) has the molecular formula C38H33N3O and a molecular weight of 547.70 g/mol. Its IUPAC name is 3,4-diphenyl-5-[4-(2,6,8-triethyldibenzofuran-4-yl)phenyl]-1,2,4-triazole.
| Compound Name | 3,4-diphenyl-5-[4-(2,6,8-triethyldibenzofuran-4-yl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 58518724 |
| Molecular Formula | C38H33N3O |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 3,4-diphenyl-5-[4-(2,6,8-triethyldibenzofuran-4-yl)phenyl]-1,2,4-triazole |
| SMILES | CCc1cc(CC)c2oc3c(-c4ccc(-c5nnc(-c6ccccc6)n5-c5ccccc5)cc4)cc(CC)cc3c2c1 |
| InChI | InChI=1S/C38H33N3O/c1-4-25-21-27(6-3)35-33(23-25)34-24-26(5-2)22-32(36(34)42-35)28-17-19-30(20-18-28)38-40-39-37(29-13-9-7-10-14-29)41(38)31-15-11-8-12-16-31/h7-24H,4-6H2,1-3H3 |
| InChIKey | ZSLMUAWDSACRMT-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |