C10H19NO6S — CID 58518849
methyl 2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]sulfanylethanimidate (PubChem CID 58518849) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]sulfanylethanimidate.
| Compound Name | methyl 2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 58518849 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]sulfanylethanimidate |
| SMILES | [H]/N=C(/CS[C@@H]1OC(C)(CO)[C@H](O)[C@H](O)C1O)OC |
| InChI | InChI=1S/C10H19NO6S/c1-10(4-12)8(15)6(13)7(14)9(17-10)18-3-5(11)16-2/h6-9,11-15H,3-4H2,1-2H3/b11-5-/t6-,7?,8-,9+,10?/m1/s1 |
| InChIKey | WBKOKHSESVTOCY-WAYXBQJPSA-N |
| XLogP | -1.47 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|