About 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one
2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one (PubChem CID 585194) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one |
| PubChem CID | 585194 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one |
| SMILES | CC1(C)Cc2nc(N)ncc2C(=O)O1 |
| InChI | InChI=1S/C9H11N3O2/c1-9(2)3-6-5(7(13)14-9)4-11-8(10)12-6/h4H,3H2,1-2H3,(H2,10,11,12) |
| InChIKey | BWFXBIZDZMOXJA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one?
The IUPAC name of 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one (CID 585194) is 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one?
The canonical SMILES for 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one is CC1(C)Cc2nc(N)ncc2C(=O)O1.
What is the InChIKey of 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one?
The InChIKey is BWFXBIZDZMOXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-9(2)3-6-5(7(13)14-9)4-11-8(10)12-6/h4H,3H2,1-2H3,(H2,10,11,12).
What are the key properties of 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one?
2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one has a molecular weight of 193.21 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,7-dimethyl-8H-pyrano[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 585194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).