C23H32N5O7PS — CID 58519475
S-[2-[2-[(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)methoxy]ethoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 58519475) has the molecular formula C23H32N5O7PS and a molecular weight of 553.58 g/mol. Its IUPAC name is S-[2-[2-[(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)methoxy]ethoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-[(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)methoxy]ethoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 58519475 |
| Molecular Formula | C23H32N5O7PS |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | S-[2-[2-[(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)methoxy]ethoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OCCOCn1cnc2c1N=C(N)CC2=O |
| InChI | InChI=1S/C23H32N5O7PS/c1-23(2,14-29)22(31)37-11-10-35-36(32,26-13-17-6-4-3-5-7-17)34-9-8-33-16-28-15-25-20-18(30)12-19(24)27-21(20)28/h3-7,15,29H,8-14,16H2,1-2H3,(H2,24,27)(H,26,32) |
| InChIKey | DGEVAKVEAJNEAB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|