C28H47NO6S — CID 58519732
3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 58519732) has the molecular formula C28H47NO6S and a molecular weight of 535.81 g/mol. Its IUPAC name is 3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | 3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 58519732 |
| Molecular Formula | C28H47NO6S |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.38 |
| IUPAC Name | 3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C(CC(=O)C[C@H](C(=O)N2CC3C(C2C(=O)O)C3(C)C)C(C)(C)C)(CS(=O)(=O)C(C)(C)C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C28H47NO6S/c1-25(2,3)19(23(31)29-16-20-21(27(20,7)8)22(29)24(32)33)14-18(30)15-28(12-10-9-11-13-28)17-36(34,35)26(4,5)6/h19-22H,9-17H2,1-8H3,(H,32,33)/t19-,20?,21?,22?/m1/s1/i9D2,10D2,11D2,12D2,13D2 |
| InChIKey | RDQZHOAFELBOMU-QSTPWTCUSA-N |
| XLogP | 4.73 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |