C13H24O2S — CID 58519742
methyl 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfanylmethyl]cyclohexane-1-carboxylate (PubChem CID 58519742) has the molecular formula C13H24O2S and a molecular weight of 253.45 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfanylmethyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfanylmethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58519742 |
| Molecular Formula | C13H24O2S |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.21 |
| IUPAC Name | methyl 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfanylmethyl]cyclohexane-1-carboxylate |
| SMILES | [2H]C([2H])([2H])C(C)(C)SCC1(C(=O)OC)CCC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C13H24O2S/c1-12(2,3)16-10-13(11(14)15-4)8-6-5-7-9-13/h5-10H2,1-4H3/i1D3,5D2,6D2,8D2 |
| InChIKey | ZITZJKRRCOBWDW-JINNUEGQSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |