C16H27NO3 — CID 58519754
methyl (1R,5S)-6,6-dimethyl-3-[(2S)-4,4,4-trideuterio-2,3-dimethyl-3-(trideuteriomethyl)butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 58519754) has the molecular formula C16H27NO3 and a molecular weight of 287.43 g/mol. Its IUPAC name is methyl (1R,5S)-6,6-dimethyl-3-[(2S)-4,4,4-trideuterio-2,3-dimethyl-3-(trideuteriomethyl)butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,5S)-6,6-dimethyl-3-[(2S)-4,4,4-trideuterio-2,3-dimethyl-3-(trideuteriomethyl)butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 58519754 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | methyl (1R,5S)-6,6-dimethyl-3-[(2S)-4,4,4-trideuterio-2,3-dimethyl-3-(trideuteriomethyl)butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | [2H]C([2H])([2H])C(C)([C@H](C)C(=O)N1C[C@H]2[C@@H](C1C(=O)OC)C2(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H27NO3/c1-9(15(2,3)4)13(18)17-8-10-11(16(10,5)6)12(17)14(19)20-7/h9-12H,8H2,1-7H3/t9-,10+,11+,12?/m1/s1/i2D3,3D3 |
| InChIKey | HKROYSJGPYKMGZ-HDOZDDAQSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |