About (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate
(1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate (PubChem CID 58519804) has the molecular formula C14H24O3
and a molecular weight of 243.36 g/mol. Its IUPAC name is (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate.
Molecular Properties
| Compound Name | (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate |
| PubChem CID | 58519804 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate |
| SMILES | [2H]C([2H])(C)CCC(C)C([2H])(OC(C)=O)C(=O)CC1CC1 |
| InChI | InChI=1S/C14H24O3/c1-4-5-6-10(2)14(17-11(3)15)13(16)9-12-7-8-12/h10,12,14H,4-9H2,1-3H3/i4D2,14D |
| InChIKey | DEYVXNWBMSXTLG-DGSFJZGSSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate?
The IUPAC name of (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate (CID 58519804) is (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate.
What is the SMILES notation for (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate?
The canonical SMILES for (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate is [2H]C([2H])(C)CCC(C)C([2H])(OC(C)=O)C(=O)CC1CC1.
What is the InChIKey of (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate?
The InChIKey is DEYVXNWBMSXTLG-DGSFJZGSSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-5-6-10(2)14(17-11(3)15)13(16)9-12-7-8-12/h10,12,14H,4-9H2,1-3H3/i4D2,14D.
What are the key properties of (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate?
(1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate has a molecular weight of 243.36 g/mol, XLogP of 3.11, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopropyl-3,7,7-trideuterio-4-methyl-2-oxooctan-3-yl) acetate is sourced from PubChem (CID 58519804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).