About 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea
3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea (PubChem CID 58519969) has the molecular formula C7H16N2O4
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea |
| PubChem CID | 58519969 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea |
| SMILES | COCN(COC)C(=O)NCCO |
| InChI | InChI=1S/C7H16N2O4/c1-12-5-9(6-13-2)7(11)8-3-4-10/h10H,3-6H2,1-2H3,(H,8,11) |
| InChIKey | QDZBIDCIMMXWNZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea?
The IUPAC name of 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea (CID 58519969) is 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea.
What is the SMILES notation for 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea?
The canonical SMILES for 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea is COCN(COC)C(=O)NCCO.
What is the InChIKey of 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea?
The InChIKey is QDZBIDCIMMXWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O4/c1-12-5-9(6-13-2)7(11)8-3-4-10/h10H,3-6H2,1-2H3,(H,8,11).
What are the key properties of 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea?
3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea has a molecular weight of 192.21 g/mol, XLogP of -0.80, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-1,1-bis(methoxymethyl)urea is sourced from PubChem (CID 58519969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).