C20H21OS+ — CID 58520281
[(3Z,5Z)-5-hydroxy-4-methylhepta-1,3,5-trien-2-yl]-diphenylsulfanium (PubChem CID 58520281) has the molecular formula C20H21OS+ and a molecular weight of 309.45 g/mol. Its IUPAC name is [(3Z,5Z)-5-hydroxy-4-methylhepta-1,3,5-trien-2-yl]-diphenylsulfanium.
| Compound Name | [(3Z,5Z)-5-hydroxy-4-methylhepta-1,3,5-trien-2-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58520281 |
| Molecular Formula | C20H21OS+ |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [(3Z,5Z)-5-hydroxy-4-methylhepta-1,3,5-trien-2-yl]-diphenylsulfanium |
| SMILES | C=C(/C=C(C)\C(O)=C\C)[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20OS/c1-4-20(21)16(2)15-17(3)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h4-15H,3H2,1-2H3/p+1/b16-15-,20-4- |
| InChIKey | AIXIYOMCENMPFF-BCBXEJKPSA-O |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|