C30H39O3S+ — CID 58520285
[(3Z,5Z)-5-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]-4-methylhepta-1,3,5-trien-2-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylsulfanium (PubChem CID 58520285) has the molecular formula C30H39O3S+ and a molecular weight of 479.71 g/mol. Its IUPAC name is [(3Z,5Z)-5-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]-4-methylhepta-1,3,5-trien-2-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylsulfanium.
| Compound Name | [(3Z,5Z)-5-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]-4-methylhepta-1,3,5-trien-2-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 58520285 |
| Molecular Formula | C30H39O3S+ |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | [(3Z,5Z)-5-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]-4-methylhepta-1,3,5-trien-2-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylsulfanium |
| SMILES | C=C/C=C(\C=C)[S+](C(=C)/C=C(C)\C(=C\C)OCC(=O)OC1(CC)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C30H39O3S/c1-7-17-26(8-2)34(27-18-13-11-14-19-27)25(6)22-24(5)28(9-3)32-23-29(31)33-30(10-4)20-15-12-16-21-30/h7-9,11,13-14,17-19,22H,1-2,6,10,12,15-16,20-21,23H2,3-5H3/q+1/b24-22-,26-17+,28-9- |
| InChIKey | MOUNAVDTSFUQDZ-DKALETMFSA-N |
| XLogP | 7.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|