About butyl-(4,4-dimethylpentyl)-diphenylphosphanium
butyl-(4,4-dimethylpentyl)-diphenylphosphanium (PubChem CID 58520425) has the molecular formula C23H34P+
and a molecular weight of 341.50 g/mol. Its IUPAC name is butyl-(4,4-dimethylpentyl)-diphenylphosphanium.
Molecular Properties
| Compound Name | butyl-(4,4-dimethylpentyl)-diphenylphosphanium |
| PubChem CID | 58520425 |
| Molecular Formula | C23H34P+ |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | butyl-(4,4-dimethylpentyl)-diphenylphosphanium |
| SMILES | CCCC[P+](CCCC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H34P/c1-5-6-19-24(20-13-18-23(2,3)4,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17H,5-6,13,18-20H2,1-4H3/q+1 |
| InChIKey | NHMZLZICWIGIMN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl-(4,4-dimethylpentyl)-diphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(4,4-dimethylpentyl)-diphenylphosphanium?
The IUPAC name of butyl-(4,4-dimethylpentyl)-diphenylphosphanium (CID 58520425) is butyl-(4,4-dimethylpentyl)-diphenylphosphanium.
What is the SMILES notation for butyl-(4,4-dimethylpentyl)-diphenylphosphanium?
The canonical SMILES for butyl-(4,4-dimethylpentyl)-diphenylphosphanium is CCCC[P+](CCCC(C)(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of butyl-(4,4-dimethylpentyl)-diphenylphosphanium?
The InChIKey is NHMZLZICWIGIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34P/c1-5-6-19-24(20-13-18-23(2,3)4,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17H,5-6,13,18-20H2,1-4H3/q+1.
What are the key properties of butyl-(4,4-dimethylpentyl)-diphenylphosphanium?
butyl-(4,4-dimethylpentyl)-diphenylphosphanium has a molecular weight of 341.50 g/mol, XLogP of 6.28, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(4,4-dimethylpentyl)-diphenylphosphanium is sourced from PubChem (CID 58520425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).