C23H34P+ — CID 58520425
butyl-(4,4-dimethylpentyl)-diphenylphosphanium (PubChem CID 58520425) has the molecular formula C23H34P+ and a molecular weight of 341.50 g/mol. Its IUPAC name is butyl-(4,4-dimethylpentyl)-diphenylphosphanium.
| Compound Name | butyl-(4,4-dimethylpentyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 58520425 |
| Molecular Formula | C23H34P+ |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | butyl-(4,4-dimethylpentyl)-diphenylphosphanium |
| SMILES | CCCC[P+](CCCC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H34P/c1-5-6-19-24(20-13-18-23(2,3)4,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17H,5-6,13,18-20H2,1-4H3/q+1 |
| InChIKey | NHMZLZICWIGIMN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|