C32H28N2O3 — CID 58520560
3',3',8-trimethyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] (PubChem CID 58520560) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3',3',8-trimethyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole].
| Compound Name | 3',3',8-trimethyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 58520560 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3',3',8-trimethyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] |
| SMILES | Cc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(-c3ccccc3)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C32H28N2O3/c1-22-19-27(34(35)36)20-26-17-18-32(37-30(22)26)31(2,3)28-11-7-8-12-29(28)33(32)21-23-13-15-25(16-14-23)24-9-5-4-6-10-24/h4-20H,21H2,1-3H3 |
| InChIKey | ZHFLBTQIWRNFCP-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|