C46H42N4O6S — CID 58520571
1'-[[4-[(3',3'-dimethyl-8-methylsulfanyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 58520571) has the molecular formula C46H42N4O6S and a molecular weight of 778.93 g/mol. Its IUPAC name is 1'-[[4-[(3',3'-dimethyl-8-methylsulfanyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[[4-[(3',3'-dimethyl-8-methylsulfanyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 58520571 |
| Molecular Formula | C46H42N4O6S |
| Molecular Weight | 778.93 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | 1'-[[4-[(3',3'-dimethyl-8-methylsulfanyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CSc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(CN3c4ccccc4C(C)(C)C34C=Cc3cc([N+](=O)[O-])cc(C)c3O4)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C46H42N4O6S/c1-29-23-34(49(51)52)24-32-19-21-45(55-41(29)32)43(2,3)36-11-7-9-13-38(36)47(45)27-30-15-17-31(18-16-30)28-48-39-14-10-8-12-37(39)44(4,5)46(48)22-20-33-25-35(50(53)54)26-40(57-6)42(33)56-46/h7-26H,27-28H2,1-6H3 |
| InChIKey | WHKJAELKCPHZRS-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.93 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|