C26H43NO10Si — CID 58520886
benzyl N-[[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-3,4-dihydroxy-5-methyloxan-2-yl]methyl]carbamate (PubChem CID 58520886) has the molecular formula C26H43NO10Si and a molecular weight of 557.71 g/mol. Its IUPAC name is benzyl N-[[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-3,4-dihydroxy-5-methyloxan-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-3,4-dihydroxy-5-methyloxan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58520886 |
| Molecular Formula | C26H43NO10Si |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | benzyl N-[[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-3,4-dihydroxy-5-methyloxan-2-yl]methyl]carbamate |
| SMILES | C[C@H]1[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)O[C@@H]2CO)O[C@@H](CNC(=O)OCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H43NO10Si/c1-15-19(29)20(30)17(12-27-25(32)33-14-16-10-8-7-9-11-16)35-24(15)36-21-18(13-28)34-23(31)22(21)37-38(5,6)26(2,3)4/h7-11,15,17-24,28-31H,12-14H2,1-6H3,(H,27,32)/t15-,17+,18-,19-,20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | QVXDGPQZBXBPQP-JUIGKAEISA-N |
| XLogP | 1.48 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|