C26H44O4Si — CID 58520966
methyl (Z)-5-[(1R,2R,4S,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4,6-dimethylcyclohexyl]-2-methyl-4-oxopent-2-enoate (PubChem CID 58520966) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is methyl (Z)-5-[(1R,2R,4S,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4,6-dimethylcyclohexyl]-2-methyl-4-oxopent-2-enoate.
| Compound Name | methyl (Z)-5-[(1R,2R,4S,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4,6-dimethylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 58520966 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl (Z)-5-[(1R,2R,4S,6R)-2-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4,6-dimethylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
| SMILES | C=C(/C=C(\C)[C@@H]1C[C@@H](C)CC(C)[C@H]1CC(=O)/C=C(/C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O4Si/c1-17-12-18(2)24(16-22(27)15-20(4)25(28)29-9)23(13-17)19(3)14-21(5)30-31(10,11)26(6,7)8/h14-15,17-18,23-24H,5,12-13,16H2,1-4,6-11H3/b19-14+,20-15-/t17-,18?,23-,24+/m0/s1 |
| InChIKey | DJEXGNOJCYQNFZ-MUJBQNNXSA-N |
| XLogP | 6.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|