C20H32O5S — CID 58521468
10-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl methanesulfonate (PubChem CID 58521468) has the molecular formula C20H32O5S and a molecular weight of 384.54 g/mol. Its IUPAC name is 10-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl methanesulfonate.
| Compound Name | 10-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl methanesulfonate |
|---|---|
| PubChem CID | 58521468 |
| Molecular Formula | C20H32O5S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 10-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl methanesulfonate |
| SMILES | CC1=C(C)C(=O)C(CCCCCCCCCCOS(C)(=O)=O)=C(C)C1=O |
| InChI | InChI=1S/C20H32O5S/c1-15-16(2)20(22)18(17(3)19(15)21)13-11-9-7-5-6-8-10-12-14-25-26(4,23)24/h5-14H2,1-4H3 |
| InChIKey | YMDCXCMCPVIHBA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|