About 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol
3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol (PubChem CID 58521562) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol.
Analyze 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol?
The IUPAC name of 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol (CID 58521562) is 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol.
What is the SMILES notation for 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol?
The canonical SMILES for 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol is OCc1[nH]nc2c1C1CCC2C1.
What is the InChIKey of 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol?
The InChIKey is OZSFAQSNYWMPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c12-4-7-8-5-1-2-6(3-5)9(8)11-10-7/h5-6,12H,1-4H2,(H,10,11).
What are the key properties of 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol?
3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol has a molecular weight of 164.21 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-5-ylmethanol is sourced from PubChem (CID 58521562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).