C22H25FN6O — CID 58521681
N-[2-[[2-[(2R)-2-(4-fluorophenyl)propyl]-6-(pyrazin-2-ylmethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 58521681) has the molecular formula C22H25FN6O and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[2-[[2-[(2R)-2-(4-fluorophenyl)propyl]-6-(pyrazin-2-ylmethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[(2R)-2-(4-fluorophenyl)propyl]-6-(pyrazin-2-ylmethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 58521681 |
| Molecular Formula | C22H25FN6O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[2-[[2-[(2R)-2-(4-fluorophenyl)propyl]-6-(pyrazin-2-ylmethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(Cc2cnccn2)nc(C[C@@H](C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H25FN6O/c1-15(17-3-5-18(23)6-4-17)11-22-28-19(12-20-14-24-7-8-26-20)13-21(29-22)27-10-9-25-16(2)30/h3-8,13-15H,9-12H2,1-2H3,(H,25,30)(H,27,28,29)/t15-/m1/s1 |
| InChIKey | CLWMGXAJGNWPFG-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|