About (4-bromo-3-fluorophenyl)methyl methanesulfonate
(4-bromo-3-fluorophenyl)methyl methanesulfonate (PubChem CID 58522007) has the molecular formula C8H8BrFO3S
and a molecular weight of 283.12 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (4-bromo-3-fluorophenyl)methyl methanesulfonate |
| PubChem CID | 58522007 |
| Molecular Formula | C8H8BrFO3S |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | (4-bromo-3-fluorophenyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C8H8BrFO3S/c1-14(11,12)13-5-6-2-3-7(9)8(10)4-6/h2-4H,5H2,1H3 |
| InChIKey | UPAZZSQNGYEFFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-3-fluorophenyl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3-fluorophenyl)methyl methanesulfonate?
The IUPAC name of (4-bromo-3-fluorophenyl)methyl methanesulfonate (CID 58522007) is (4-bromo-3-fluorophenyl)methyl methanesulfonate.
What is the SMILES notation for (4-bromo-3-fluorophenyl)methyl methanesulfonate?
The canonical SMILES for (4-bromo-3-fluorophenyl)methyl methanesulfonate is CS(=O)(=O)OCc1ccc(Br)c(F)c1.
What is the InChIKey of (4-bromo-3-fluorophenyl)methyl methanesulfonate?
The InChIKey is UPAZZSQNGYEFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFO3S/c1-14(11,12)13-5-6-2-3-7(9)8(10)4-6/h2-4H,5H2,1H3.
What are the key properties of (4-bromo-3-fluorophenyl)methyl methanesulfonate?
(4-bromo-3-fluorophenyl)methyl methanesulfonate has a molecular weight of 283.12 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3-fluorophenyl)methyl methanesulfonate is sourced from PubChem (CID 58522007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).