C19H31BrN4O2Si — CID 58522117
2-bromo-N-[(2S)-3,3-dimethylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 58522117) has the molecular formula C19H31BrN4O2Si and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-3,3-dimethylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-[(2S)-3,3-dimethylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 58522117 |
| Molecular Formula | C19H31BrN4O2Si |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-bromo-N-[(2S)-3,3-dimethylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Br)nc12)C(C)(C)C |
| InChI | InChI=1S/C19H31BrN4O2Si/c1-13(19(2,3)4)22-18(25)14-11-24(12-26-8-9-27(5,6)7)17-16(14)23-15(20)10-21-17/h10-11,13H,8-9,12H2,1-7H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | CFEHXZPXYBEOHD-ZDUSSCGKSA-N |
| XLogP | 4.67 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|