C18H29BrN4O3Si — CID 58522286
2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 58522286) has the molecular formula C18H29BrN4O3Si and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 58522286 |
| Molecular Formula | C18H29BrN4O3Si |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Br)nc12 |
| InChI | InChI=1S/C18H29BrN4O3Si/c1-18(2,11-24)10-21-17(25)13-9-23(12-26-6-7-27(3,4)5)16-15(13)22-14(19)8-20-16/h8-9,24H,6-7,10-12H2,1-5H3,(H,21,25) |
| InChIKey | SAPUVDIDNPSOQC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|