C5H10F3NO — CID 58522343
(2S,3S)-3-amino-1,1,1-trifluoro-2-methylbutan-2-ol (PubChem CID 58522343) has the molecular formula C5H10F3NO and a molecular weight of 157.13 g/mol. Its IUPAC name is (2S,3S)-3-amino-1,1,1-trifluoro-2-methylbutan-2-ol.
| Compound Name | (2S,3S)-3-amino-1,1,1-trifluoro-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 58522343 |
| Molecular Formula | C5H10F3NO |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2S,3S)-3-amino-1,1,1-trifluoro-2-methylbutan-2-ol |
| SMILES | C[C@H](N)[C@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C5H10F3NO/c1-3(9)4(2,10)5(6,7)8/h3,10H,9H2,1-2H3/t3-,4-/m0/s1 |
| InChIKey | CFJFWTAYJHNSDJ-IMJSIDKUSA-N |
| XLogP | 0.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |