C24H26FN5O4 — CID 58522906
N-[(3S)-6-acetamido-1-[4-(4-fluorophenoxy)phenyl]-2-oxohexan-3-yl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 58522906) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[(3S)-6-acetamido-1-[4-(4-fluorophenoxy)phenyl]-2-oxohexan-3-yl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(3S)-6-acetamido-1-[4-(4-fluorophenoxy)phenyl]-2-oxohexan-3-yl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 58522906 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[(3S)-6-acetamido-1-[4-(4-fluorophenoxy)phenyl]-2-oxohexan-3-yl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CC(=O)NCCC[C@H](NC(=O)Cn1cncn1)C(=O)Cc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H26FN5O4/c1-17(31)27-12-2-3-22(29-24(33)14-30-16-26-15-28-30)23(32)13-18-4-8-20(9-5-18)34-21-10-6-19(25)7-11-21/h4-11,15-16,22H,2-3,12-14H2,1H3,(H,27,31)(H,29,33)/t22-/m0/s1 |
| InChIKey | BDJKEWIKVFOZOY-QFIPXVFZSA-N |
| XLogP | 2.42 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|