C27H32N6O5 — CID 58523298
(5S)-5-[(5-ethyl-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[3-hydroxy-6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]acetyl]imidazolidine-2,4-dione (PubChem CID 58523298) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is (5S)-5-[(5-ethyl-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[3-hydroxy-6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]acetyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(5-ethyl-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[3-hydroxy-6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]acetyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58523298 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (5S)-5-[(5-ethyl-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[3-hydroxy-6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]acetyl]imidazolidine-2,4-dione |
| SMILES | CCc1ccc2c(c1)C(=O)N(C[C@@]1(C(=O)Cc3nc(NC4CCN(C)CC4)ccc3O)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H32N6O5/c1-3-16-4-5-17-14-33(24(36)19(17)12-16)15-27(25(37)30-26(38)31-27)22(35)13-20-21(34)6-7-23(29-20)28-18-8-10-32(2)11-9-18/h4-7,12,18,34H,3,8-11,13-15H2,1-2H3,(H,28,29)(H2,30,31,37,38)/t27-/m0/s1 |
| InChIKey | NLCRLWFKEVCKBU-MHZLTWQESA-N |
| XLogP | 1.20 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|