C22H16F2N4O5 — CID 58523373
4-[2-[(4R)-4-[(4,6-difluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzamide (PubChem CID 58523373) has the molecular formula C22H16F2N4O5 and a molecular weight of 454.39 g/mol. Its IUPAC name is 4-[2-[(4R)-4-[(4,6-difluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzamide.
| Compound Name | 4-[2-[(4R)-4-[(4,6-difluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58523373 |
| Molecular Formula | C22H16F2N4O5 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 4-[2-[(4R)-4-[(4,6-difluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzamide |
| SMILES | COc1c(F)cc2c(c1F)C(=O)N(C[C@@]1(C#Cc3ccc(C(N)=O)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C22H16F2N4O5/c1-33-17-14(23)8-13-9-28(19(30)15(13)16(17)24)10-22(20(31)26-21(32)27-22)7-6-11-2-4-12(5-3-11)18(25)29/h2-5,8H,9-10H2,1H3,(H2,25,29)(H2,26,27,31,32)/t22-/m1/s1 |
| InChIKey | SRTSBUBQUINJBK-JOCHJYFZSA-N |
| XLogP | 0.66 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|