C24H28ClF2N5 — CID 58523436
2-[4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-4-methyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-3-yl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 58523436) has the molecular formula C24H28ClF2N5 and a molecular weight of 459.97 g/mol. Its IUPAC name is 2-[4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-4-methyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-3-yl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-4-methyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-3-yl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 58523436 |
| Molecular Formula | C24H28ClF2N5 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-4-methyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-3-yl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | Cc1c(-c2cnn(CCN(C)C)c2)cnc2c1N(Cc1c(F)ccc(F)c1Cl)CCCC2 |
| InChI | InChI=1S/C24H28ClF2N5/c1-16-18(17-12-29-32(14-17)11-10-30(2)3)13-28-22-6-4-5-9-31(24(16)22)15-19-20(26)7-8-21(27)23(19)25/h7-8,12-14H,4-6,9-11,15H2,1-3H3 |
| InChIKey | BALJSDZAAUYJSI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|