C29H27ClF2N6OS — CID 58523644
[3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 58523644) has the molecular formula C29H27ClF2N6OS and a molecular weight of 581.09 g/mol. Its IUPAC name is [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58523644 |
| Molecular Formula | C29H27ClF2N6OS |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cccc(-c2csc(-c3cnc4c(n3)N(Cc3c(F)ccc(F)c3Cl)CCCC4)n2)c1)N1CCNCC1 |
| InChI | InChI=1S/C29H27ClF2N6OS/c30-26-20(21(31)7-8-22(26)32)16-38-11-2-1-6-23-27(38)35-24(15-34-23)28-36-25(17-40-28)18-4-3-5-19(14-18)29(39)37-12-9-33-10-13-37/h3-5,7-8,14-15,17,33H,1-2,6,9-13,16H2 |
| InChIKey | CATDWWRZAYLEFG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|