About 1-adamantylmethyl 3-(trifluoromethyl)benzoate
1-adamantylmethyl 3-(trifluoromethyl)benzoate (PubChem CID 585241) has the molecular formula C19H21F3O2
and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-adamantylmethyl 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 3-(trifluoromethyl)benzoate |
| PubChem CID | 585241 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-adamantylmethyl 3-(trifluoromethyl)benzoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3O2/c20-19(21,22)16-3-1-2-15(7-16)17(23)24-11-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14H,4-6,8-11H2 |
| InChIKey | DSWANJGNZVGIPM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantylmethyl 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 3-(trifluoromethyl)benzoate?
The IUPAC name of 1-adamantylmethyl 3-(trifluoromethyl)benzoate (CID 585241) is 1-adamantylmethyl 3-(trifluoromethyl)benzoate.
What is the SMILES notation for 1-adamantylmethyl 3-(trifluoromethyl)benzoate?
The canonical SMILES for 1-adamantylmethyl 3-(trifluoromethyl)benzoate is O=C(OCC12CC3CC(CC(C3)C1)C2)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-adamantylmethyl 3-(trifluoromethyl)benzoate?
The InChIKey is DSWANJGNZVGIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3O2/c20-19(21,22)16-3-1-2-15(7-16)17(23)24-11-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14H,4-6,8-11H2.
What are the key properties of 1-adamantylmethyl 3-(trifluoromethyl)benzoate?
1-adamantylmethyl 3-(trifluoromethyl)benzoate has a molecular weight of 338.37 g/mol, XLogP of 5.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 585241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).