About [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine
[4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine (PubChem CID 58524219) has the molecular formula C21H15Cl2N3
and a molecular weight of 380.28 g/mol. Its IUPAC name is [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine |
| PubChem CID | 58524219 |
| Molecular Formula | C21H15Cl2N3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3cc(Cl)c(Cl)cc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3/c22-16-10-18-19(11-17(16)23)26-21(15-8-6-13(12-24)7-9-15)20(25-18)14-4-2-1-3-5-14/h1-11H,12,24H2 |
| InChIKey | NVLNMNLWEZFVOC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine?
The IUPAC name of [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine (CID 58524219) is [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine.
What is the SMILES notation for [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine?
The canonical SMILES for [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine is NCc1ccc(-c2nc3cc(Cl)c(Cl)cc3nc2-c2ccccc2)cc1.
What is the InChIKey of [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine?
The InChIKey is NVLNMNLWEZFVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2N3/c22-16-10-18-19(11-17(16)23)26-21(15-8-6-13(12-24)7-9-15)20(25-18)14-4-2-1-3-5-14/h1-11H,12,24H2.
What are the key properties of [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine?
[4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine has a molecular weight of 380.28 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6,7-dichloro-3-phenylquinoxalin-2-yl)phenyl]methanamine is sourced from PubChem (CID 58524219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).