About 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine
2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine (PubChem CID 58524245) has the molecular formula C23H18N2O2
and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine |
| PubChem CID | 58524245 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine |
| SMILES | c1ccc(-c2cc3cccnc3nc2-c2ccc(C3OCCO3)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O2/c1-2-5-16(6-3-1)20-15-19-7-4-12-24-22(19)25-21(20)17-8-10-18(11-9-17)23-26-13-14-27-23/h1-12,15,23H,13-14H2 |
| InChIKey | QDDNOQZNQVODQB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine?
The IUPAC name of 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine (CID 58524245) is 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine.
What is the SMILES notation for 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine?
The canonical SMILES for 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine is c1ccc(-c2cc3cccnc3nc2-c2ccc(C3OCCO3)cc2)cc1.
What is the InChIKey of 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine?
The InChIKey is QDDNOQZNQVODQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O2/c1-2-5-16(6-3-1)20-15-19-7-4-12-24-22(19)25-21(20)17-8-10-18(11-9-17)23-26-13-14-27-23/h1-12,15,23H,13-14H2.
What are the key properties of 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine?
2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine has a molecular weight of 354.41 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-dioxolan-2-yl)phenyl]-3-phenyl-1,8-naphthyridine is sourced from PubChem (CID 58524245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).