About (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate
(5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate (PubChem CID 58524749) has the molecular formula C16H11F3N2O4S
and a molecular weight of 384.34 g/mol. Its IUPAC name is (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate |
| PubChem CID | 58524749 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate |
| SMILES | COc1nccc2nc(OS(=O)(=O)C(F)(F)F)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C16H11F3N2O4S/c1-24-14-12-9-11(10-5-3-2-4-6-10)15(21-13(12)7-8-20-14)25-26(22,23)16(17,18)19/h2-9H,1H3 |
| InChIKey | HSZSLTRKFNCIQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate?
The IUPAC name of (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate (CID 58524749) is (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate is COc1nccc2nc(OS(=O)(=O)C(F)(F)F)c(-c3ccccc3)cc12.
What is the InChIKey of (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate?
The InChIKey is HSZSLTRKFNCIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O4S/c1-24-14-12-9-11(10-5-3-2-4-6-10)15(21-13(12)7-8-20-14)25-26(22,23)16(17,18)19/h2-9H,1H3.
What are the key properties of (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate?
(5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate has a molecular weight of 384.34 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-3-phenyl-1,6-naphthyridin-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 58524749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).