C32H28N4O2 — CID 58524983
9-(5-hydroxy-1H-inden-2-yl)-1-(3-methyl-4-piperazin-1-ylphenyl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 58524983) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 9-(5-hydroxy-1H-inden-2-yl)-1-(3-methyl-4-piperazin-1-ylphenyl)benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(5-hydroxy-1H-inden-2-yl)-1-(3-methyl-4-piperazin-1-ylphenyl)benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58524983 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 9-(5-hydroxy-1H-inden-2-yl)-1-(3-methyl-4-piperazin-1-ylphenyl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | Cc1cc(-n2c(=O)ccc3cnc4ccc(C5=Cc6cc(O)ccc6C5)cc4c32)ccc1N1CCNCC1 |
| InChI | InChI=1S/C32H28N4O2/c1-20-14-26(5-8-30(20)35-12-10-33-11-13-35)36-31(38)9-4-23-19-34-29-7-3-22(18-28(29)32(23)36)24-15-21-2-6-27(37)17-25(21)16-24/h2-9,14,16-19,33,37H,10-13,15H2,1H3 |
| InChIKey | DZANEKHTFWHQAL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|