C15H20F3NO — CID 58525019
4-[4-tert-butyl-2-(trifluoromethyl)phenyl]morpholine (PubChem CID 58525019) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[4-tert-butyl-2-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-[4-tert-butyl-2-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 58525019 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[4-tert-butyl-2-(trifluoromethyl)phenyl]morpholine |
| SMILES | CC(C)(C)c1ccc(N2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO/c1-14(2,3)11-4-5-13(12(10-11)15(16,17)18)19-6-8-20-9-7-19/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | NYHJEIMVGPKIBF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |